4C-T-7
1-[2,5-Dimethoxy-4-(propylsulfanyl)phenyl]butan-2-amine
 7381  C15H25NO2S  283.43
 InChI=1S/C15H25NO2S/c1-5-7-19-15-10-13(17-3)11(8-12(16)6-2)9-14(15)18-4/h9-10,12H,5-8,16H2,1-4H3
 RGZBRSAMNZVOHP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(OC)c(cc1OC)CC(CC)N