N-Me-ALEPH-7
1-[2,5-Dimethoxy-4-(propylsulfanyl)phenyl]-N-methylpropan-2-amine
 7380  C15H25NO2S  283.43
 InChI=1S/C15H25NO2S/c1-6-7-19-15-10-13(17-4)12(8-11(2)16-3)9-14(15)18-5/h9-11,16H,6-8H2,1-5H3
 QXAMLVSXDQXILL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(OC)c(cc1OC)CC(NC)C