BOPS
2-[2,5-Dimethoxy-4-(propylsulfanyl)phenyl]-2-methoxyethan-1-amine
 7378  C14H23NO3S  285.402
 InChI=1S/C14H23NO3S/c1-5-6-19-14-8-11(16-2)10(7-12(14)17-3)13(9-15)18-4/h7-8,13H,5-6,9,15H2,1-4H3
 VURRPHKKQVZMGW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(OC)c(cc1OC)C(OC)CN