N-Me-4C-T-2
1-[4-(Ethylsulfanyl)-2,5-dimethoxyphenyl]-N-methylbutan-2-amine
 7372  C15H25NO2S  283.43
 InChI=1S/C15H25NO2S/c1-6-12(16-3)8-11-9-14(18-5)15(19-7-2)10-13(11)17-4/h9-10,12,16H,6-8H2,1-5H3
 UUGSPZDEDYQIBI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCSc1cc(OC)c(cc1OC)CC(NC)CC