N-Me-ALEPH
1-[2,5-Dimethoxy-4-(methylsulfanyl)phenyl]-N-methylpropan-2-amine
 7364 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-9(14-2)6-10-7-12(16-4)13(17-5)8-11(10)15-3/h7-9,14H,6H2,1-5H3
 HSFQBCBKMINXBH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cc(OC)c(cc1OC)SC)C