Nortetrazepam
7-Chloro-5-(cyclohex-1-en-1-yl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one
 7347 C15H15ClN2O 274.745
 Aryldiazepine
 InChI=1S/C15H15ClN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h4,6-8H,1-3,5,9H2,(H,18,19)
 FDRMSENAXZDFTN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C1CN=C(c2c(N1)ccc(c2)Cl)C1=CCCCC1