Nitizolam
4-(2-Chlorophenyl)-9-methyl-2-nitro-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
 7345 C15H10ClN5O2S 359.79
 Aryldiazepine
 InChI=1S/C15H10ClN5O2S/c1-8-18-19-12-7-17-14(9-4-2-3-5-11(9)16)10-6-13(21(22)23)24-15(10)20(8)12/h2-6H,7H2,1H3
 UVEOAIMZJCZMCS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Clc1ccccc1C1=NCc2n(c3c1cc(s3)N(=O)=O)c(nn2)C