4,5,2-2C-T-7
2-[4,5-Dimethoxy-2-(propylsulfanyl)phenyl]ethan-1-amine
 7330 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-7-17-13-9-12(16-3)11(15-2)8-10(13)5-6-14/h8-9H,4-7,14H2,1-3H3
 WBUPODDKBKBOOW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1SCCC)OC