1-Methyltryptamine
2-(1-Methyl-1H-indol-3-yl)ethan-1-amine
 7294  C11H14N2  174.242
 InChI=1S/C11H14N2/c1-13-8-9(6-7-12)10-4-2-3-5-11(10)13/h2-5,8H,6-7,12H2,1H3
 CAAGZPJPCKMFBD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cn(c2c1cccc2)C