5-Ethynyl-DMT
2-(5-Ethynyl-1H-indol-3-yl)-N,N-dimethylethan-1-amine
 7279 C14H16N2 212.29
 Prophetic?
 InChI=1S/C14H16N2/c1-4-11-5-6-14-13(9-11)12(10-15-14)7-8-16(2)3/h1,5-6,9-10,15H,7-8H2,2-3H3
 FDMPXQPYULWBKG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)c(CCN(C)C)c[nH]2