4-Hydroxyethyl-DMT
2-{3-[2-(Dimethylamino)ethyl]-1H-indol-4-yl}ethan-1-ol
 7277 C14H20N2O 232.321
 Prophetic?
 InChI=1S/C14H20N2O/c1-16(2)8-6-12-10-15-13-5-3-4-11(7-9-17)14(12)13/h3-5,10,15,17H,6-9H2,1-2H3
 JRULMGDDJUQERX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCCc1cccc2c1c(CCN(C)C)c[nH]2