BOE
2-(4-Ethyl-2,5-dimethoxyphenyl)-2-methoxyethan-1-amine
 7262 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-5-9-6-12(16-3)10(7-11(9)15-2)13(8-14)17-4/h6-7,13H,5,8,14H2,1-4H3
 IJTKRVQOZAXRFT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(c1cc(OC)c(cc1OC)CC)CN