5-Hydroxy-4-methyl-DMT
3-[2-(Dimethylamino)ethyl]-4-methyl-1H-indol-5-ol
 7258  C13H18N2O  218.295
 Prophetic?
 InChI=1S/C13H18N2O/c1-9-12(16)5-4-11-13(9)10(8-14-11)6-7-15(2)3/h4-5,8,14,16H,6-7H2,1-3H3
 JOEDPCOQLOHLPE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1c(C)c(O)cc2)C