2C-HM
4-(2-Aminoethyl)-2,5-dimethoxybenzaldehyde
 7253 C11H15NO3 209.242
 InChI=1S/C11H15NO3/c1-14-10-6-9(7-13)11(15-2)5-8(10)3-4-12/h5-7H,3-4,12H2,1-2H3
 ZDHYVCBZXIAZEJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C=O