2C-BF-5
2-(4,7-Dimethoxy-1-benzofuran-5-yl)ethan-1-amine
 7249 C12H15NO3 221.252
 Prophetic?
 InChI=1S/C12H15NO3/c1-14-10-7-8(3-5-13)11(15-2)9-4-6-16-12(9)10/h4,6-7H,3,5,13H2,1-2H3
 AHKODJLUWOPEJM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c2c(c1OC)cco2