DOFM
1-[4-(Fluoromethyl)-2,5-dimethoxyphenyl]propan-2-amine
 7234  C12H18FNO2  227.275
 InChI=1S/C12H18FNO2/c1-8(14)4-9-5-12(16-3)10(7-13)6-11(9)15-2/h5-6,8H,4,7,14H2,1-3H3
 ZKRHJAGMXZBOMW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CF)c(cc1CC(N)C)OC