α,β,β-Me-DOM
3-(2,5-Dimethoxy-4-methylphenyl)-2,3-dimethylbutan-2-amine
 7225 C15H25NO2 251.365
 InChI=1S/C15H25NO2/c1-10-8-13(18-7)11(9-12(10)17-6)14(2,3)15(4,5)16/h8-9H,16H2,1-7H3
 QKZMHYUHNBTCBN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(c(cc1C)OC)C(C(N)(C)C)(C)C