N-Et-DOM
1-(2,5-Dimethoxy-4-methylphenyl)-N-ethylpropan-2-amine
 7220 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-6-15-11(3)8-12-9-13(16-4)10(2)7-14(12)17-5/h7,9,11,15H,6,8H2,1-5H3
 PXLLXGNICMWTLR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cc(OC)c(cc1OC)C)C