N,N-Me-DOM
1-(2,5-Dimethoxy-4-methylphenyl)-N,N-dimethylpropan-2-amine
 7219 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-10-7-14(17-6)12(9-13(10)16-5)8-11(2)15(3)4/h7,9,11H,8H2,1-6H3
 RIYIPRFZCLNQIN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1CC(N(C)C)C)OC