β,β-Me-DOM
3-(2,5-Dimethoxy-4-methylphenyl)-3-methylbutan-2-amine
 7214 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-9-7-13(17-6)11(8-12(9)16-5)14(3,4)10(2)15/h7-8,10H,15H2,1-6H3
 CKUGFDMXIPCUTB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(c(cc1C)OC)C(C(N)C)(C)C