β-Me-DOM
3-(2,5-Dimethoxy-4-methylphenyl)butan-2-amine
 7213 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-8-6-13(16-5)11(7-12(8)15-4)9(2)10(3)14/h6-7,9-10H,14H2,1-5H3
 MTAIXXOMFWYAKQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1C(C(N)C)C)OC