β,β-Me-2C-D
2-(2,5-Dimethoxy-4-methylphenyl)-2-methylpropan-1-amine
 7212 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-9-6-12(16-5)10(7-11(9)15-4)13(2,3)8-14/h6-7H,8,14H2,1-5H3
 QOWFVOPMTRYLAK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(c(cc1C)OC)C(CN)(C)C