DON-Ac
N-[1-(2,5-Dimethoxy-4-nitrophenyl)propan-2-yl]acetamide
 7204 C13H18N2O5 282.292
 InChI=1S/C13H18N2O5/c1-8(14-9(2)16)5-10-6-13(20-4)11(15(17)18)7-12(10)19-3/h6-8H,5H2,1-4H3,(H,14,16)
 VDFHKWJVOLLLPO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(N(=O)=O)c(cc1CC(NC(=O)C)C)OC