BON
2-(2,5-Dimethoxy-4-nitrophenyl)-2-methoxyethan-1-amine
 7202 C11H16N2O5 256.255
 InChI=1S/C11H16N2O5/c1-16-9-5-8(13(14)15)10(17-2)4-7(9)11(6-12)18-3/h4-5,11H,6,12H2,1-3H3
 AACPSSCTUJOCJK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(c1cc(OC)c(cc1OC)N(=O)=O)CN