DONH-Ac
N-[1-(4-Amino-2,5-dimethoxyphenyl)propan-2-yl]acetamide
 7181 C13H20N2O3 252.31
 InChI=1S/C13H20N2O3/c1-8(15-9(2)16)5-10-6-13(18-4)11(14)7-12(10)17-3/h6-8H,5,14H2,1-4H3,(H,15,16)
 OYKWOWFSIDPSQC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(N)c(cc1CC(NC(=O)C)C)OC