2,5-INHA
N-Hydroxy-1-(4-iodo-2,5-dimethoxyphenyl)propan-2-amine
 7166 C11H16INO3 337.154
 InChI=1S/C11H16INO3/c1-7(13-14)4-8-5-11(16-3)9(12)6-10(8)15-2/h5-7,13-14H,4H2,1-3H3
 NCMQBVDCEKNHMV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONC(Cc1cc(OC)c(cc1OC)I)C