2,5-INAA
[1-(4-Iodo-2,5-dimethoxyphenyl)propan-2-yl]hydrazine
 7165 C11H17IN2O2 336.169
 InChI=1S/C11H17IN2O2/c1-7(14-13)4-8-5-11(16-3)9(12)6-10(8)15-2/h5-7,14H,4,13H2,1-3H3
 SJRPTJCFOILFJD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNC(Cc1cc(OC)c(cc1OC)I)C