DOB-βk
2-Amino-1-(4-bromo-2,5-dimethoxyphenyl)propan-1-one
 7156 C11H14BrNO3 288.138
 InChI=1S/C11H14BrNO3/c1-6(13)11(14)7-4-10(16-3)8(12)5-9(7)15-2/h4-6H,13H2,1-3H3
 NFDUSHHXFRLENI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(c(cc1Br)OC)C(=O)C(N)C