BOBE
2-(4-Bromo-2,5-dimethoxyphenyl)-2-ethoxyethan-1-amine
 7153 C12H18BrNO3 304.18
 InChI=1S/C12H18BrNO3/c1-4-17-12(7-14)8-5-11(16-3)9(13)6-10(8)15-2/h5-6,12H,4,7,14H2,1-3H3
 RLBQXMJUZPQTGS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(c1cc(OC)c(cc1OC)Br)CN