5,2,4-DOET
1-(5-Ethyl-2,4-dimethoxyphenyl)propan-2-amine
 7106 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-10-7-11(6-9(2)14)13(16-4)8-12(10)15-3/h7-9H,5-6,14H2,1-4H3
 DBWFYUPXUNUCLZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCc1cc(CC(N)C)c(cc1OC)OC