CMP-Ac
N-[1-(Cyclohexa-1,4-dien-1-yl)propan-2-yl]-N-methylacetamide
 7097 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-10(13(3)11(2)14)9-12-7-5-4-6-8-12/h4-5,8,10H,6-7,9H2,1-3H3
 JBBMSUMYNWHENL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C(=O)C)C)CC1=CCC=CC1