3,5,2-2C-T-7
2-[3,5-Dimethoxy-2-(propylsulfanyl)phenyl]ethan-1-amine
 7073 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-7-17-13-10(5-6-14)8-11(15-2)9-12(13)16-3/h8-9H,4-7,14H2,1-3H3
 ALZGRVSDFROQAN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1c(CCN)cc(cc1OC)OC