2,3,5-BMM
2-(2-Bromo-3,5-dimethylphenyl)ethan-1-amine
 7065  C10H14BrN  228.129
 InChI=1S/C10H14BrN/c1-7-5-8(2)10(11)9(6-7)3-4-12/h5-6H,3-4,12H2,1-2H3
 YIGGWNXZPBLWJO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(C)cc(c1Br)C