3-DOM
1-(2,5-Dimethoxy-3-methylphenyl)propan-2-amine
 7062 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-8-5-11(14-3)7-10(6-9(2)13)12(8)15-4/h5,7,9H,6,13H2,1-4H3
 XZYCPUFGPVSHSQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c(c1)C)OC