3-DOB
1-(3-Bromo-2,5-dimethoxyphenyl)propan-2-amine
 7060 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-7(13)4-8-5-9(14-2)6-10(12)11(8)15-3/h5-7H,4,13H2,1-3H3
 HCZXNFSMGJKVHO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c(c1)Br)OC