2,3,5-MBM
2-(3-Bromo-2,5-dimethylphenyl)ethan-1-amine
 7059  C10H14BrN  228.129
 InChI=1S/C10H14BrN/c1-7-5-9(3-4-12)8(2)10(11)6-7/h5-6H,3-4,12H2,1-2H3
 PKHDQEALKJDESR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(C)cc(c1C)Br