2,3,5-MMB
2-(5-Bromo-2,3-dimethoxyphenyl)ethan-1-amine
 7053 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-9-6-8(11)5-7(3-4-12)10(9)14-2/h5-6H,3-4,12H2,1-2H3
 YZRUNEIBGYBZHT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(Br)cc(c1OC)OC