3,4,2-2C-T-7
2-[3,4-Dimethoxy-2-(propylsulfanyl)phenyl]ethan-1-amine
 7021 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-9-17-13-10(7-8-14)5-6-11(15-2)12(13)16-3/h5-6H,4,7-9,14H2,1-3H3
 IVOZQSVNIOUKBK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1c(CCN)ccc(c1OC)OC