N-Me-TMA-3
N-Methyl-1-(2,3,4-trimethoxyphenyl)propan-2-amine
 7016 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-9(14-2)8-10-6-7-11(15-3)13(17-5)12(10)16-4/h6-7,9,14H,8H2,1-5H3
 HHLOEWSDUOAEAF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(c(c1OC)OC)OC)C