2,3,4-BMM
2-(2-Bromo-3,4-dimethoxyphenyl)ethan-1-amine
 7010 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-8-4-3-7(5-6-12)9(11)10(8)14-2/h3-4H,5-6,12H2,1-2H3
 UHMSZPHIAIRIPP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1Br)OC)OC