3-Me-2,4-DOM
1-(2,4-Dimethoxy-3-methylphenyl)propan-2-amine
 7006 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-8(13)7-10-5-6-11(14-3)9(2)12(10)15-4/h5-6,8H,7,13H2,1-4H3
 XCEORCNVPWLEAY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(ccc(c1C)OC)CC(N)C