2,3,4-MBM
2-(3-Bromo-2,4-dimethoxyphenyl)ethan-1-amine
 7004 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-8-4-3-7(5-6-12)10(14-2)9(8)11/h3-4H,5-6,12H2,1-2H3
 CRIDYCYLLZGEBT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1OC)Br)OC