TMeA-3
1-(2,3,4-Trimethylphenyl)propan-2-amine
 7001 C12H19N 177.286
 InChI=1S/C12H19N/c1-8-5-6-12(7-9(2)13)11(4)10(8)3/h5-6,9H,7,13H2,1-4H3
 RITOPGTURTUAQS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(c(c1C)C)C)N