1-Demethyl-phenazolam
8-Bromo-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine
 6986  C16H10BrClN4  373.634
 Aryldiazepine
 InChI=1S/C16H10BrClN4/c17-10-5-6-14-12(7-10)16(11-3-1-2-4-13(11)18)19-8-15-21-20-9-22(14)15/h1-7,9H,8H2
 HGHGSOBPNPCMHF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Brc1ccc2c(c1)C(=NCc1n2cnn1)c1ccccc1Cl