4,2,3-DOB
1-(4-Bromo-2,3-dimethoxyphenyl)propan-2-amine
 6977 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-7(13)6-8-4-5-9(12)11(15-3)10(8)14-2/h4-5,7H,6,13H2,1-3H3
 VERVNXXUCNQDRY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(ccc(c1OC)Br)CC(N)C