2,3,4-MMB
2-(4-Bromo-2,3-dimethoxyphenyl)ethan-1-amine
 6976 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-9-7(5-6-12)3-4-8(11)10(9)14-2/h3-4H,5-6,12H2,1-2H3
 JIISJVWSLPVLLY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1OC)OC)Br