N-Me-2,6-DMA
1-(2,6-Dimethoxyphenyl)-N-methylpropan-2-amine
 6974 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-9(13-2)8-10-11(14-3)6-5-7-12(10)15-4/h5-7,9,13H,8H2,1-4H3
 WEDYLLPFCUVSFH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1c(OC)cccc1OC)C