2,6-HPEA
2-(2-Aminoethyl)benzene-1,3-diol
 6965 C8H11NO2 153.178
 InChI=1S/C8H11NO2/c9-5-4-6-7(10)2-1-3-8(6)11/h1-3,10-11H,4-5,9H2
 JWAHCKQUFUFATP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(O)cccc1O