BBAT
7-(Dibutylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6964 C18H29NO 275.429
 InChI=1S/C18H29NO/c1-3-5-12-19(13-6-4-2)16-11-10-15-8-7-9-18(20)17(15)14-16/h7-9,16,20H,3-6,10-14H2,1-2H3
 SYSODJPJTHIXAV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCN(C1CCc2c(C1)c(O)ccc2)CCCC