BHAT
7-(Butylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6963 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-2-3-9-15-12-8-7-11-5-4-6-14(16)13(11)10-12/h4-6,12,15-16H,2-3,7-10H2,1H3
 ZFVINDZATYSXBW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNC1CCc2c(C1)c(O)ccc2